C22H24N2O7 — CID 68927732
(1S)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid (PubChem CID 68927732) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is (1S)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid.
| Compound Name | (1S)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 68927732 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (1S)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
| SMILES | COCCOCOc1ccc2c(c1)[C@H]1CN(C(=O)N1OCc1ccccc1)C2C(=O)O |
| InChI | InChI=1S/C22H24N2O7/c1-28-9-10-29-14-30-16-7-8-17-18(11-16)19-12-23(20(17)21(25)26)22(27)24(19)31-13-15-5-3-2-4-6-15/h2-8,11,19-20H,9-10,12-14H2,1H3,(H,25,26)/t19-,20?/m1/s1 |
| InChIKey | UOMIDLMGASGBSQ-FIWHBWSRSA-N |
| XLogP | 2.74 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|