C24H27N3O9 — CID 69346418
ethyl 4-(2-methoxyethoxymethoxy)-5-nitro-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate (PubChem CID 69346418) has the molecular formula C24H27N3O9 and a molecular weight of 501.49 g/mol. Its IUPAC name is ethyl 4-(2-methoxyethoxymethoxy)-5-nitro-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate.
| Compound Name | ethyl 4-(2-methoxyethoxymethoxy)-5-nitro-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 69346418 |
| Molecular Formula | C24H27N3O9 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | ethyl 4-(2-methoxyethoxymethoxy)-5-nitro-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
| SMILES | CCOC(=O)C1c2cc([N+](=O)[O-])c(OCOCCOC)cc2C2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O9/c1-3-34-23(28)22-18-11-19(27(30)31)21(35-15-33-10-9-32-2)12-17(18)20-13-25(22)24(29)26(20)36-14-16-7-5-4-6-8-16/h4-8,11-12,20,22H,3,9-10,13-15H2,1-2H3 |
| InChIKey | VUNHDDJEDLYDJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 129.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|