C23H28N2O10 — CID 6709919
ethyl (2R,3S)-2-hydroxy-3-[5-(2-methoxyethoxymethoxy)-2-nitrophenyl]-3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 6709919) has the molecular formula C23H28N2O10 and a molecular weight of 492.48 g/mol. Its IUPAC name is ethyl (2R,3S)-2-hydroxy-3-[5-(2-methoxyethoxymethoxy)-2-nitrophenyl]-3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2R,3S)-2-hydroxy-3-[5-(2-methoxyethoxymethoxy)-2-nitrophenyl]-3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 6709919 |
| Molecular Formula | C23H28N2O10 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl (2R,3S)-2-hydroxy-3-[5-(2-methoxyethoxymethoxy)-2-nitrophenyl]-3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](NC(=O)OCc1ccccc1)c1cc(OCOCCOC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N2O10/c1-3-33-22(27)21(26)20(24-23(28)34-14-16-7-5-4-6-8-16)18-13-17(9-10-19(18)25(29)30)35-15-32-12-11-31-2/h4-10,13,20-21,26H,3,11-12,14-15H2,1-2H3,(H,24,28)/t20-,21+/m0/s1 |
| InChIKey | DXNTUMOERCRIHR-LEWJYISDSA-N |
| XLogP | 2.49 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|