About [2-(iodomethyl)phenyl] trifluoromethanesulfonate
[2-(iodomethyl)phenyl] trifluoromethanesulfonate (PubChem CID 89393110) has the molecular formula C8H6F3IO3S
and a molecular weight of 366.10 g/mol. Its IUPAC name is [2-(iodomethyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-(iodomethyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 89393110 |
| Molecular Formula | C8H6F3IO3S |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | [2-(iodomethyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccccc1CI)C(F)(F)F |
| InChI | InChI=1S/C8H6F3IO3S/c9-8(10,11)16(13,14)15-7-4-2-1-3-6(7)5-12/h1-4H,5H2 |
| InChIKey | CTNJYEAMCXTBIY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-(iodomethyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(iodomethyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [2-(iodomethyl)phenyl] trifluoromethanesulfonate (CID 89393110) is [2-(iodomethyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-(iodomethyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [2-(iodomethyl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccccc1CI)C(F)(F)F.
What is the InChIKey of [2-(iodomethyl)phenyl] trifluoromethanesulfonate?
The InChIKey is CTNJYEAMCXTBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3IO3S/c9-8(10,11)16(13,14)15-7-4-2-1-3-6(7)5-12/h1-4H,5H2.
What are the key properties of [2-(iodomethyl)phenyl] trifluoromethanesulfonate?
[2-(iodomethyl)phenyl] trifluoromethanesulfonate has a molecular weight of 366.10 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(iodomethyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 89393110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).