About (2-hydroxyselanylphenyl) trifluoromethanesulfonate
(2-hydroxyselanylphenyl) trifluoromethanesulfonate (PubChem CID 101376046) has the molecular formula C7H5F3O4SSe
and a molecular weight of 321.13 g/mol. Its IUPAC name is (2-hydroxyselanylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-hydroxyselanylphenyl) trifluoromethanesulfonate |
| PubChem CID | 101376046 |
| Molecular Formula | C7H5F3O4SSe |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 321.90 |
| IUPAC Name | (2-hydroxyselanylphenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccccc1[Se]O)C(F)(F)F |
| InChI | InChI=1S/C7H5F3O4SSe/c8-7(9,10)15(11,12)14-5-3-1-2-4-6(5)16-13/h1-4,13H |
| InChIKey | SJIXEWKXELNHQF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyselanylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyselanylphenyl) trifluoromethanesulfonate?
The IUPAC name of (2-hydroxyselanylphenyl) trifluoromethanesulfonate (CID 101376046) is (2-hydroxyselanylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (2-hydroxyselanylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (2-hydroxyselanylphenyl) trifluoromethanesulfonate is O=S(=O)(Oc1ccccc1[Se]O)C(F)(F)F.
What is the InChIKey of (2-hydroxyselanylphenyl) trifluoromethanesulfonate?
The InChIKey is SJIXEWKXELNHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O4SSe/c8-7(9,10)15(11,12)14-5-3-1-2-4-6(5)16-13/h1-4,13H.
What are the key properties of (2-hydroxyselanylphenyl) trifluoromethanesulfonate?
(2-hydroxyselanylphenyl) trifluoromethanesulfonate has a molecular weight of 321.13 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyselanylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 101376046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).