About ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate
ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 90713872) has the molecular formula C26H28F3NO7S
and a molecular weight of 556.58 g/mol. Its IUPAC name is ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate.
Molecular Properties
| Compound Name | ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate |
| PubChem CID | 90713872 |
| Molecular Formula | C26H28F3NO7S |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | CC.COC(=O)c1ccccc1OS(=O)(=O)C(F)(F)F.[2H]c1cccc(N(C)c2ccccc2C(=O)OC)c1 |
| InChI | InChI=1S/C15H15NO2.C9H7F3O5S.C2H6/c1-16(12-8-4-3-5-9-12)14-11-7-6-10-13(14)15(17)18-2;1-16-8(13)6-4-2-3-5-7(6)17-18(14,15)9(10,11)12;1-2/h3-11H,1-2H3;2-5H,1H3;1-2H3/i4D;; |
| InChIKey | RDXQBTAKJAYUOG-FGRQWAPSSA-N |
| XLogP | 5.97 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate?
The IUPAC name of ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate (CID 90713872) is ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate.
What is the SMILES notation for ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate?
The canonical SMILES for ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate is CC.COC(=O)c1ccccc1OS(=O)(=O)C(F)(F)F.[2H]c1cccc(N(C)c2ccccc2C(=O)OC)c1.
What is the InChIKey of ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate?
The InChIKey is RDXQBTAKJAYUOG-FGRQWAPSSA-N. The full InChI is InChI=1S/C15H15NO2.C9H7F3O5S.C2H6/c1-16(12-8-4-3-5-9-12)14-11-7-6-10-13(14)15(17)18-2;1-16-8(13)6-4-2-3-5-7(6)17-18(14,15)9(10,11)12;1-2/h3-11H,1-2H3;2-5H,1H3;1-2H3/i4D;;.
What are the key properties of ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate?
ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate has a molecular weight of 556.58 g/mol, XLogP of 5.97, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-(3-deuterio-N-methylanilino)benzoate;methyl 2-(trifluoromethylsulfonyloxy)benzoate is sourced from PubChem (CID 90713872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).