C20H32BrNO4Si — CID 67483090
ethyl 2-[[4-[1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzoyl]amino]propanoate (PubChem CID 67483090) has the molecular formula C20H32BrNO4Si and a molecular weight of 458.47 g/mol. Its IUPAC name is ethyl 2-[[4-[1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzoyl]amino]propanoate.
| Compound Name | ethyl 2-[[4-[1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67483090 |
| Molecular Formula | C20H32BrNO4Si |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | ethyl 2-[[4-[1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1ccc(C(Br)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32BrNO4Si/c1-8-25-19(24)14(2)22-18(23)16-11-9-15(10-12-16)17(21)13-26-27(6,7)20(3,4)5/h9-12,14,17H,8,13H2,1-7H3,(H,22,23) |
| InChIKey | GRCNIGGXJSLPSR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|