C22H27N3O4 — CID 119806767
ethyl 2-[[4-[(3-amino-2-methyl-3-phenylpropanoyl)amino]benzoyl]amino]propanoate (PubChem CID 119806767) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 2-[[4-[(3-amino-2-methyl-3-phenylpropanoyl)amino]benzoyl]amino]propanoate.
| Compound Name | ethyl 2-[[4-[(3-amino-2-methyl-3-phenylpropanoyl)amino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 119806767 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 2-[[4-[(3-amino-2-methyl-3-phenylpropanoyl)amino]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1ccc(NC(=O)C(C)C(N)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-4-29-22(28)15(3)24-21(27)17-10-12-18(13-11-17)25-20(26)14(2)19(23)16-8-6-5-7-9-16/h5-15,19H,4,23H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | NPWNKZLNDSOPII-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |