C21H26ClN3O4 — CID 120611424
ethyl 2-[[4-[3-(2-aminophenyl)propanoylamino]benzoyl]amino]propanoate;hydrochloride (PubChem CID 120611424) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is ethyl 2-[[4-[3-(2-aminophenyl)propanoylamino]benzoyl]amino]propanoate;hydrochloride.
| Compound Name | ethyl 2-[[4-[3-(2-aminophenyl)propanoylamino]benzoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 120611424 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | ethyl 2-[[4-[3-(2-aminophenyl)propanoylamino]benzoyl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)NC(=O)c1ccc(NC(=O)CCc2ccccc2N)cc1.Cl |
| InChI | InChI=1S/C21H25N3O4.ClH/c1-3-28-21(27)14(2)23-20(26)16-8-11-17(12-9-16)24-19(25)13-10-15-6-4-5-7-18(15)22;/h4-9,11-12,14H,3,10,13,22H2,1-2H3,(H,23,26)(H,24,25);1H |
| InChIKey | ZZAPXHMHBKIVCB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|