C20H32F3NO6SSi — CID 166461095
[4-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate (PubChem CID 166461095) has the molecular formula C20H32F3NO6SSi and a molecular weight of 499.62 g/mol. Its IUPAC name is [4-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166461095 |
| Molecular Formula | C20H32F3NO6SSi |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [4-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H32F3NO6SSi/c1-18(2,3)29-17(25)24-16(13-28-32(7,8)19(4,5)6)14-9-11-15(12-10-14)30-31(26,27)20(21,22)23/h9-12,16H,13H2,1-8H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | GAXGETBYSJCNRN-INIZCTEOSA-N |
| XLogP | 5.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|