C14H23NO5SSi — CID 167723901
2-[tert-butyl(dimethyl)silyl]oxy-5-(methanesulfonamido)benzoic acid (PubChem CID 167723901) has the molecular formula C14H23NO5SSi and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-5-(methanesulfonamido)benzoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-5-(methanesulfonamido)benzoic acid |
|---|---|
| PubChem CID | 167723901 |
| Molecular Formula | C14H23NO5SSi |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-5-(methanesulfonamido)benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NS(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C14H23NO5SSi/c1-14(2,3)22(5,6)20-12-8-7-10(15-21(4,18)19)9-11(12)13(16)17/h7-9,15H,1-6H3,(H,16,17) |
| InChIKey | JRGMEBSCZIZWEG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|