C16H25NO3Si — CID 167715007
N-[3-acetyl-4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetamide (PubChem CID 167715007) has the molecular formula C16H25NO3Si and a molecular weight of 307.47 g/mol. Its IUPAC name is N-[3-acetyl-4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetamide.
| Compound Name | N-[3-acetyl-4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 167715007 |
| Molecular Formula | C16H25NO3Si |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[3-acetyl-4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(O[Si](C)(C)C(C)(C)C)c(C(C)=O)c1 |
| InChI | InChI=1S/C16H25NO3Si/c1-11(18)14-10-13(17-12(2)19)8-9-15(14)20-21(6,7)16(3,4)5/h8-10H,1-7H3,(H,17,19) |
| InChIKey | GFCNIXOBEBGXJM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|