C13H19IO3Si — CID 167731636
2-[tert-butyl(dimethyl)silyl]oxy-4-iodobenzoic acid (PubChem CID 167731636) has the molecular formula C13H19IO3Si and a molecular weight of 378.28 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobenzoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobenzoic acid |
|---|---|
| PubChem CID | 167731636 |
| Molecular Formula | C13H19IO3Si |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-iodobenzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(I)ccc1C(=O)O |
| InChI | InChI=1S/C13H19IO3Si/c1-13(2,3)18(4,5)17-11-8-9(14)6-7-10(11)12(15)16/h6-8H,1-5H3,(H,15,16) |
| InChIKey | PYBHRYJZRGWYLH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|