C15H23IO3Si — CID 19375763
3-[2-[tert-butyl(dimethyl)silyl]oxy-5-iodophenyl]propanoic acid (PubChem CID 19375763) has the molecular formula C15H23IO3Si and a molecular weight of 406.34 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-iodophenyl]propanoic acid.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-iodophenyl]propanoic acid |
|---|---|
| PubChem CID | 19375763 |
| Molecular Formula | C15H23IO3Si |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxy-5-iodophenyl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(I)cc1CCC(=O)O |
| InChI | InChI=1S/C15H23IO3Si/c1-15(2,3)20(4,5)19-13-8-7-12(16)10-11(13)6-9-14(17)18/h7-8,10H,6,9H2,1-5H3,(H,17,18) |
| InChIKey | CPSQHMPYLRLYJR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|