C13H20N2OSi — CID 45123455
3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonitrile (PubChem CID 45123455) has the molecular formula C13H20N2OSi and a molecular weight of 248.40 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonitrile.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 45123455 |
| Molecular Formula | C13H20N2OSi |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cnccc1C#N |
| InChI | InChI=1S/C13H20N2OSi/c1-13(2,3)17(4,5)16-10-12-9-15-7-6-11(12)8-14/h6-7,9H,10H2,1-5H3 |
| InChIKey | OIRVLEZFCASPBU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|