C18H27N3OSi — CID 67264770
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-methyl-N-pyridin-3-ylpyridin-2-amine (PubChem CID 67264770) has the molecular formula C18H27N3OSi and a molecular weight of 329.52 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-methyl-N-pyridin-3-ylpyridin-2-amine.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-methyl-N-pyridin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 67264770 |
| Molecular Formula | C18H27N3OSi |
| Molecular Weight | 329.52 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-methyl-N-pyridin-3-ylpyridin-2-amine |
| SMILES | CN(c1cccnc1)c1ncccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H27N3OSi/c1-18(2,3)23(5,6)22-14-15-9-7-12-20-17(15)21(4)16-10-8-11-19-13-16/h7-13H,14H2,1-6H3 |
| InChIKey | UOSHVUMFHJYKPG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|