C17H24F3N3OSi — CID 140612635
tert-butyl-dimethyl-[[2-[2-(1,1,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane (PubChem CID 140612635) has the molecular formula C17H24F3N3OSi and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[2-[2-(1,1,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[2-[2-(1,1,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane |
|---|---|
| PubChem CID | 140612635 |
| Molecular Formula | C17H24F3N3OSi |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | tert-butyl-dimethyl-[[2-[2-(1,1,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccnc1-c1ccnn1C(F)(F)CF |
| InChI | InChI=1S/C17H24F3N3OSi/c1-16(2,3)25(4,5)24-11-13-7-6-9-21-15(13)14-8-10-22-23(14)17(19,20)12-18/h6-10H,11-12H2,1-5H3 |
| InChIKey | OVHVQDIUUYJHAG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|