C19H27FO2S2Si — CID 19033989
tert-butyl-[[6-[[2-(fluoromethyl)phenoxy]methyl]dithiin-3-yl]methoxy]-dimethylsilane (PubChem CID 19033989) has the molecular formula C19H27FO2S2Si and a molecular weight of 398.64 g/mol. Its IUPAC name is tert-butyl-[[6-[[2-(fluoromethyl)phenoxy]methyl]dithiin-3-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-[[2-(fluoromethyl)phenoxy]methyl]dithiin-3-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 19033989 |
| Molecular Formula | C19H27FO2S2Si |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tert-butyl-[[6-[[2-(fluoromethyl)phenoxy]methyl]dithiin-3-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC=C(COc2ccccc2CF)SS1 |
| InChI | InChI=1S/C19H27FO2S2Si/c1-19(2,3)25(4,5)22-14-17-11-10-16(23-24-17)13-21-18-9-7-6-8-15(18)12-20/h6-11H,12-14H2,1-5H3 |
| InChIKey | SVTIERJXGLPWND-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|