C28H34O4Si — CID 22014377
4-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]-2-(2-methylphenyl)benzoic acid (PubChem CID 22014377) has the molecular formula C28H34O4Si and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]-2-(2-methylphenyl)benzoic acid.
| Compound Name | 4-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]-2-(2-methylphenyl)benzoic acid |
|---|---|
| PubChem CID | 22014377 |
| Molecular Formula | C28H34O4Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]-2-(2-methylphenyl)benzoic acid |
| SMILES | Cc1ccccc1-c1cc(COc2ccccc2CO[Si](C)(C)C(C)(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C28H34O4Si/c1-20-11-7-9-13-23(20)25-17-21(15-16-24(25)27(29)30)18-31-26-14-10-8-12-22(26)19-32-33(5,6)28(2,3)4/h7-17H,18-19H2,1-6H3,(H,29,30) |
| InChIKey | WOTFWLKXLFMNBS-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|