C19H33FOSi — CID 140891502
tert-butyl-[[2-fluoro-3-(2-methylpentan-2-yl)phenyl]methoxy]-dimethylsilane (PubChem CID 140891502) has the molecular formula C19H33FOSi and a molecular weight of 324.56 g/mol. Its IUPAC name is tert-butyl-[[2-fluoro-3-(2-methylpentan-2-yl)phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-fluoro-3-(2-methylpentan-2-yl)phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 140891502 |
| Molecular Formula | C19H33FOSi |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | tert-butyl-[[2-fluoro-3-(2-methylpentan-2-yl)phenyl]methoxy]-dimethylsilane |
| SMILES | CCCC(C)(C)c1cccc(CO[Si](C)(C)C(C)(C)C)c1F |
| InChI | InChI=1S/C19H33FOSi/c1-9-13-19(5,6)16-12-10-11-15(17(16)20)14-21-22(7,8)18(2,3)4/h10-12H,9,13-14H2,1-8H3 |
| InChIKey | QDOFHCJGCVFSNE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|