C13H20F3NOSi — CID 162684753
tert-butyl-[2,2-difluoro-2-(3-fluoro-2-pyridinyl)ethoxy]-dimethylsilane (PubChem CID 162684753) has the molecular formula C13H20F3NOSi and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-2-(3-fluoro-2-pyridinyl)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2,2-difluoro-2-(3-fluoro-2-pyridinyl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 162684753 |
| Molecular Formula | C13H20F3NOSi |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | tert-butyl-[2,2-difluoro-2-(3-fluoro-2-pyridinyl)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)c1ncccc1F |
| InChI | InChI=1S/C13H20F3NOSi/c1-12(2,3)19(4,5)18-9-13(15,16)11-10(14)7-6-8-17-11/h6-8H,9H2,1-5H3 |
| InChIKey | RRTVMUXHYGDXGK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|