C13H23FO2SSi — CID 102119549
3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-thiophen-3-ylpropan-1-ol (PubChem CID 102119549) has the molecular formula C13H23FO2SSi and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-thiophen-3-ylpropan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 102119549 |
| Molecular Formula | C13H23FO2SSi |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-thiophen-3-ylpropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(CO)c1ccsc1 |
| InChI | InChI=1S/C13H23FO2SSi/c1-12(2,3)18(4,5)16-10-13(14,9-15)11-6-7-17-8-11/h6-8,15H,9-10H2,1-5H3 |
| InChIKey | RSLCCVJBEDRLDM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|