C9H9N3O2 — CID 130672000
(2S)-2-amino-3-(4-cyano-3-pyridinyl)propanoic acid (PubChem CID 130672000) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-cyano-3-pyridinyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-cyano-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 130672000 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (2S)-2-amino-3-(4-cyano-3-pyridinyl)propanoic acid |
| SMILES | N#Cc1ccncc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H9N3O2/c10-4-6-1-2-12-5-7(6)3-8(11)9(13)14/h1-2,5,8H,3,11H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | VFECHSLXZMQGPM-QMMMGPOBSA-N |
| XLogP | -0.09 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |