C18H25NO2SSi — CID 150527966
4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-1-benzothiophene-7-carbonitrile (PubChem CID 150527966) has the molecular formula C18H25NO2SSi and a molecular weight of 347.56 g/mol. Its IUPAC name is 4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-1-benzothiophene-7-carbonitrile.
| Compound Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-1-benzothiophene-7-carbonitrile |
|---|---|
| PubChem CID | 150527966 |
| Molecular Formula | C18H25NO2SSi |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-1-benzothiophene-7-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1ccc(C#N)c2sccc12 |
| InChI | InChI=1S/C18H25NO2SSi/c1-18(2,3)23(4,5)21-11-6-10-20-16-8-7-14(13-19)17-15(16)9-12-22-17/h7-9,12H,6,10-11H2,1-5H3 |
| InChIKey | IDFPPHUBLUCPJZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|