C18H34OSSi — CID 140913096
tert-butyl-dimethyl-(8-thiophen-2-yloctoxy)silane (PubChem CID 140913096) has the molecular formula C18H34OSSi and a molecular weight of 326.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-(8-thiophen-2-yloctoxy)silane.
| Compound Name | tert-butyl-dimethyl-(8-thiophen-2-yloctoxy)silane |
|---|---|
| PubChem CID | 140913096 |
| Molecular Formula | C18H34OSSi |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl-dimethyl-(8-thiophen-2-yloctoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCCc1cccs1 |
| InChI | InChI=1S/C18H34OSSi/c1-18(2,3)21(4,5)19-15-11-9-7-6-8-10-13-17-14-12-16-20-17/h12,14,16H,6-11,13,15H2,1-5H3 |
| InChIKey | LKQUDUOYQCQPBT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|