C26H33N3OSSi — CID 177309411
2-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]anilino]-4-(4-methyl-1,3-thiazol-5-yl)benzonitrile (PubChem CID 177309411) has the molecular formula C26H33N3OSSi and a molecular weight of 463.72 g/mol. Its IUPAC name is 2-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]anilino]-4-(4-methyl-1,3-thiazol-5-yl)benzonitrile.
| Compound Name | 2-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]anilino]-4-(4-methyl-1,3-thiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 177309411 |
| Molecular Formula | C26H33N3OSSi |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]anilino]-4-(4-methyl-1,3-thiazol-5-yl)benzonitrile |
| SMILES | Cc1ncsc1-c1ccc(C#N)c(N(CCCO[Si](C)(C)C(C)(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H33N3OSSi/c1-20-25(31-19-28-20)21-13-14-22(18-27)24(17-21)29(23-11-8-7-9-12-23)15-10-16-30-32(5,6)26(2,3)4/h7-9,11-14,17,19H,10,15-16H2,1-6H3 |
| InChIKey | RMLBVEOBGFVEJL-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|