C22H29F4NO3Si — CID 68547693
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,4-bis(difluoromethoxy)-N-phenylaniline (PubChem CID 68547693) has the molecular formula C22H29F4NO3Si and a molecular weight of 459.56 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,4-bis(difluoromethoxy)-N-phenylaniline.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,4-bis(difluoromethoxy)-N-phenylaniline |
|---|---|
| PubChem CID | 68547693 |
| Molecular Formula | C22H29F4NO3Si |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,4-bis(difluoromethoxy)-N-phenylaniline |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(c1ccccc1)c1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C22H29F4NO3Si/c1-22(2,3)31(4,5)28-14-13-27(16-9-7-6-8-10-16)17-11-12-18(29-20(23)24)19(15-17)30-21(25)26/h6-12,15,20-21H,13-14H2,1-5H3 |
| InChIKey | FGLAVRKJQFCIAA-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|