C25H45NO3Si2 — CID 139740845
3-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]prop-2-enal (PubChem CID 139740845) has the molecular formula C25H45NO3Si2 and a molecular weight of 463.81 g/mol. Its IUPAC name is 3-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]prop-2-enal.
| Compound Name | 3-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 139740845 |
| Molecular Formula | C25H45NO3Si2 |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 3-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]prop-2-enal |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)c1ccc(C=CC=O)cc1 |
| InChI | InChI=1S/C25H45NO3Si2/c1-24(2,3)30(7,8)28-20-17-26(18-21-29-31(9,10)25(4,5)6)23-15-13-22(14-16-23)12-11-19-27/h11-16,19H,17-18,20-21H2,1-10H3 |
| InChIKey | OZTDGGLERXKVSN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|