C32H54N2O2Si2 — CID 170900396
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]phenyl]ethenyl]-N-methylaniline (PubChem CID 170900396) has the molecular formula C32H54N2O2Si2 and a molecular weight of 554.97 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]phenyl]ethenyl]-N-methylaniline.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]phenyl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 170900396 |
| Molecular Formula | C32H54N2O2Si2 |
| Molecular Weight | 554.97 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]phenyl]ethenyl]-N-methylaniline |
| SMILES | C=C(c1ccc(N(C)CCO[Si](C)(C)C(C)(C)C)cc1)c1ccc(N(C)CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H54N2O2Si2/c1-26(27-14-18-29(19-15-27)33(8)22-24-35-37(10,11)31(2,3)4)28-16-20-30(21-17-28)34(9)23-25-36-38(12,13)32(5,6)7/h14-21H,1,22-25H2,2-13H3 |
| InChIKey | VNEOQMASPCOEGU-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.97 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|