C16H28BNO5Si — CID 58420009
3-borono-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]benzoic acid (PubChem CID 58420009) has the molecular formula C16H28BNO5Si and a molecular weight of 353.30 g/mol. Its IUPAC name is 3-borono-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]benzoic acid.
| Compound Name | 3-borono-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 58420009 |
| Molecular Formula | C16H28BNO5Si |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-borono-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]benzoic acid |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)c1cc(B(O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H28BNO5Si/c1-16(2,3)24(5,6)23-8-7-18(4)14-10-12(15(19)20)9-13(11-14)17(21)22/h9-11,21-22H,7-8H2,1-6H3,(H,19,20) |
| InChIKey | QSJCNOROCYVKQR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|