C14H24N4OSi — CID 122154492
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrazine-2-carbonitrile (PubChem CID 122154492) has the molecular formula C14H24N4OSi and a molecular weight of 292.46 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 122154492 |
| Molecular Formula | C14H24N4OSi |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrazine-2-carbonitrile |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)c1nccnc1C#N |
| InChI | InChI=1S/C14H24N4OSi/c1-14(2,3)20(5,6)19-10-9-18(4)13-12(11-15)16-7-8-17-13/h7-8H,9-10H2,1-6H3 |
| InChIKey | XLXQBDWBPNZYBM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|