C15H27N3O3Si — CID 176747637
methyl 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrimidine-4-carboxylate (PubChem CID 176747637) has the molecular formula C15H27N3O3Si and a molecular weight of 325.49 g/mol. Its IUPAC name is methyl 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrimidine-4-carboxylate.
| Compound Name | methyl 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 176747637 |
| Molecular Formula | C15H27N3O3Si |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | methyl 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(N(C)CCO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H27N3O3Si/c1-15(2,3)22(6,7)21-11-10-18(4)14-16-9-8-12(17-14)13(19)20-5/h8-9H,10-11H2,1-7H3 |
| InChIKey | CBNWYBVFGSGWSH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|