C24H55NO4Si3 — CID 91743862
[tert-butyl(dimethyl)silyl] 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetate (PubChem CID 91743862) has the molecular formula C24H55NO4Si3 and a molecular weight of 505.97 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetate |
|---|---|
| PubChem CID | 91743862 |
| Molecular Formula | C24H55NO4Si3 |
| Molecular Weight | 505.97 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetate |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)CC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H55NO4Si3/c1-22(2,3)30(10,11)27-18-16-25(17-19-28-31(12,13)23(4,5)6)20-21(26)29-32(14,15)24(7,8)9/h16-20H2,1-15H3 |
| InChIKey | DPXHPUVAAJIVRG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.97 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|