C29H63N3O10Si5 — CID 91745582
trimethylsilyl 2-[bis[2-[bis(2-oxo-2-trimethylsilyloxyethyl)amino]ethyl]amino]acetate (PubChem CID 91745582) has the molecular formula C29H63N3O10Si5 and a molecular weight of 754.26 g/mol. Its IUPAC name is trimethylsilyl 2-[bis[2-[bis(2-oxo-2-trimethylsilyloxyethyl)amino]ethyl]amino]acetate.
| Compound Name | trimethylsilyl 2-[bis[2-[bis(2-oxo-2-trimethylsilyloxyethyl)amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 91745582 |
| Molecular Formula | C29H63N3O10Si5 |
| Molecular Weight | 754.26 g/mol |
| Exact Mass | 753.34 |
| IUPAC Name | trimethylsilyl 2-[bis[2-[bis(2-oxo-2-trimethylsilyloxyethyl)amino]ethyl]amino]acetate |
| SMILES | C[Si](C)(C)OC(=O)CN(CCN(CC(=O)O[Si](C)(C)C)CC(=O)O[Si](C)(C)C)CCN(CC(=O)O[Si](C)(C)C)CC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C29H63N3O10Si5/c1-43(2,3)38-25(33)20-30(16-18-31(21-26(34)39-44(4,5)6)22-27(35)40-45(7,8)9)17-19-32(23-28(36)41-46(10,11)12)24-29(37)42-47(13,14)15/h16-24H2,1-15H3 |
| InChIKey | KRXHLFPROIOQMS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 141.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|