C12H24N2O6 — CID 19426049
methyl 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 19426049) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 19426049 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | methyl 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CCN(CCO)CCO)CC(=O)OC |
| InChI | InChI=1S/C12H24N2O6/c1-19-11(17)9-14(10-12(18)20-2)4-3-13(5-7-15)6-8-16/h15-16H,3-10H2,1-2H3 |
| InChIKey | XFWQWLAYMRRFPB-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |