About 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate
2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate (PubChem CID 175527812) has the molecular formula C10H21NO6
and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate |
| PubChem CID | 175527812 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate |
| SMILES | COC(=O)C(C)=O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C4H6O3/c8-4-1-7(2-5-9)3-6-10;1-3(5)4(6)7-2/h8-10H,1-6H2;1-2H3 |
| InChIKey | QNCYICZLGAQUKL-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate (CID 175527812) is 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate is COC(=O)C(C)=O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate?
The InChIKey is QNCYICZLGAQUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C4H6O3/c8-4-1-7(2-5-9)3-6-10;1-3(5)4(6)7-2/h8-10H,1-6H2;1-2H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate?
2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate has a molecular weight of 251.28 g/mol, XLogP of -1.99, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;methyl 2-oxopropanoate is sourced from PubChem (CID 175527812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).