C27H39NO2S2Si — CID 176889309
5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl-methylamino]phenyl]thieno[3,2-b]thiophene-2-carbaldehyde (PubChem CID 176889309) has the molecular formula C27H39NO2S2Si and a molecular weight of 501.83 g/mol. Its IUPAC name is 5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl-methylamino]phenyl]thieno[3,2-b]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl-methylamino]phenyl]thieno[3,2-b]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 176889309 |
| Molecular Formula | C27H39NO2S2Si |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl-methylamino]phenyl]thieno[3,2-b]thiophene-2-carbaldehyde |
| SMILES | CN(CCCCCCCO[Si](C)(C)C(C)(C)C)c1ccc(-c2cc3sc(C=O)cc3s2)cc1 |
| InChI | InChI=1S/C27H39NO2S2Si/c1-27(2,3)33(5,6)30-17-11-9-7-8-10-16-28(4)22-14-12-21(13-15-22)24-19-26-25(32-24)18-23(20-29)31-26/h12-15,18-20H,7-11,16-17H2,1-6H3 |
| InChIKey | TWRIWDNPOAQPEF-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|