C49H77NO6S2Si — CID 58609105
3,4-dibutoxy-5-[(E)-2-[3,4-dibutoxy-5-[(E)-2-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl-ethylamino]phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde (PubChem CID 58609105) has the molecular formula C49H77NO6S2Si and a molecular weight of 868.38 g/mol. Its IUPAC name is 3,4-dibutoxy-5-[(E)-2-[3,4-dibutoxy-5-[(E)-2-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl-ethylamino]phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde.
| Compound Name | 3,4-dibutoxy-5-[(E)-2-[3,4-dibutoxy-5-[(E)-2-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl-ethylamino]phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 58609105 |
| Molecular Formula | C49H77NO6S2Si |
| Molecular Weight | 868.38 g/mol |
| Exact Mass | 867.50 |
| IUPAC Name | 3,4-dibutoxy-5-[(E)-2-[3,4-dibutoxy-5-[(E)-2-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl-ethylamino]phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde |
| SMILES | CCCCOc1c(C=O)sc(/C=C/c2sc(/C=C/c3ccc(N(CC)CCCCCCO[Si](C)(C)C(C)(C)C)cc3)c(OCCCC)c2OCCCC)c1OCCCC |
| InChI | InChI=1S/C49H77NO6S2Si/c1-11-16-33-52-45-41(29-26-39-24-27-40(28-25-39)50(15-5)32-22-20-21-23-37-56-59(9,10)49(6,7)8)57-42(46(45)53-34-17-12-2)30-31-43-47(54-35-18-13-3)48(44(38-51)58-43)55-36-19-14-4/h24-31,38H,11-23,32-37H2,1-10H3/b29-26+,31-30+ |
| InChIKey | PBGSSCZTCUKVDT-WRIFKRQOSA-N |
| XLogP | 15.09 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.38 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|