C30H49NO2SSi — CID 131843520
3-[(E)-2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]ethenyl]-2-butylsulfanyl-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 131843520) has the molecular formula C30H49NO2SSi and a molecular weight of 515.88 g/mol. Its IUPAC name is 3-[(E)-2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]ethenyl]-2-butylsulfanyl-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(E)-2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]ethenyl]-2-butylsulfanyl-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 131843520 |
| Molecular Formula | C30H49NO2SSi |
| Molecular Weight | 515.88 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 3-[(E)-2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-ethylamino]phenyl]ethenyl]-2-butylsulfanyl-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CCCCSC1=C(/C=C/c2ccc(N(CC)CCO[Si](C)(C)C(C)(C)C)cc2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C30H49NO2SSi/c1-10-12-21-34-28-25(22-30(6,7)23-27(28)32)16-13-24-14-17-26(18-15-24)31(11-2)19-20-33-35(8,9)29(3,4)5/h13-18H,10-12,19-23H2,1-9H3/b16-13+ |
| InChIKey | UHMRPEQMNHSHKU-DTQAZKPQSA-N |
| XLogP | 8.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.88 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|