C25H35NO3S — CID 11362428
5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-3,4-dibutylthiophene-2-carbaldehyde (PubChem CID 11362428) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is 5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-3,4-dibutylthiophene-2-carbaldehyde.
| Compound Name | 5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-3,4-dibutylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 11362428 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-3,4-dibutylthiophene-2-carbaldehyde |
| SMILES | CCCCc1c(C=O)sc(/C=C/c2ccc(N(CCO)CCO)cc2)c1CCCC |
| InChI | InChI=1S/C25H35NO3S/c1-3-5-7-22-23(8-6-4-2)25(19-29)30-24(22)14-11-20-9-12-21(13-10-20)26(15-17-27)16-18-28/h9-14,19,27-28H,3-8,15-18H2,1-2H3/b14-11+ |
| InChIKey | BHGVHLLQHDQRRC-SDNWHVSQSA-N |
| XLogP | 5.21 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|