C20H22N2OS — CID 121278374
2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-propylanilino]ethanol (PubChem CID 121278374) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-propylanilino]ethanol.
| Compound Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-propylanilino]ethanol |
|---|---|
| PubChem CID | 121278374 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-propylanilino]ethanol |
| SMILES | CCCN(CCO)c1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H22N2OS/c1-2-13-22(14-15-23)17-10-7-16(8-11-17)9-12-20-21-18-5-3-4-6-19(18)24-20/h3-12,23H,2,13-15H2,1H3/b12-9+ |
| InChIKey | IUWAAFLMEHVHRP-FMIVXFBMSA-N |
| XLogP | 4.68 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|