C35H26N2S — CID 10896445
4-[(E)-2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 10896445) has the molecular formula C35H26N2S and a molecular weight of 506.67 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 10896445 |
| Molecular Formula | C35H26N2S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | C(=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)\c1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C35H26N2S/c1-3-9-30(10-4-1)37(31-11-5-2-6-12-31)32-24-21-29(22-25-32)20-17-27-15-18-28(19-16-27)23-26-35-36-33-13-7-8-14-34(33)38-35/h1-26H/b20-17+,26-23+ |
| InChIKey | JCRINETUFLBONI-REVCRRCWSA-N |
| XLogP | 10.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|