C19H11N3S — CID 71374813
2-[[4-[2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]methylidene]propanedinitrile (PubChem CID 71374813) has the molecular formula C19H11N3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-[[4-[2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 71374813 |
| Molecular Formula | C19H11N3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[4-[2-(1,3-benzothiazol-2-yl)ethenyl]phenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(C=Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H11N3S/c20-12-16(13-21)11-15-7-5-14(6-8-15)9-10-19-22-17-3-1-2-4-18(17)23-19/h1-11H |
| InChIKey | NKGBDWZYVUVLFP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|