C17H9N3OS — CID 163947507
2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]methylidene]propanedinitrile (PubChem CID 163947507) has the molecular formula C17H9N3OS and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 163947507 |
| Molecular Formula | C17H9N3OS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(-c2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C17H9N3OS/c18-9-12(10-19)7-11-5-6-13(15(21)8-11)17-20-14-3-1-2-4-16(14)22-17/h1-8,21H |
| InChIKey | RWKLGDIZZLJCDN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|