C24H12F3N3OS — CID 137123919
2-[[4-[2-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-yl]phenyl]methylidene]propanedinitrile (PubChem CID 137123919) has the molecular formula C24H12F3N3OS and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-[[4-[2-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-yl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[2-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-yl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 137123919 |
| Molecular Formula | C24H12F3N3OS |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[[4-[2-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-yl]phenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(-c2ccc3nc(-c4ccc(C(F)(F)F)cc4O)sc3c2)cc1 |
| InChI | InChI=1S/C24H12F3N3OS/c25-24(26,27)18-6-7-19(21(31)11-18)23-30-20-8-5-17(10-22(20)32-23)16-3-1-14(2-4-16)9-15(12-28)13-29/h1-11,31H |
| InChIKey | OIFJLEIWEHQWEO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|