C17H12N2O3S — CID 4797184
2-(1,3-benzothiazol-2-yl)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enenitrile (PubChem CID 4797184) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4797184 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc3ccccc3s2)cc(O)c1O |
| InChI | InChI=1S/C17H12N2O3S/c1-22-14-8-10(7-13(20)16(14)21)6-11(9-18)17-19-12-4-2-3-5-15(12)23-17/h2-8,20-21H,1H3 |
| InChIKey | FQVVDTRFYKDWEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|