C26H16N2OS — CID 177464380
4-[4-(1,3-benzothiazol-2-yl)-5-hydroxy-2-phenylphenyl]benzonitrile (PubChem CID 177464380) has the molecular formula C26H16N2OS and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)-5-hydroxy-2-phenylphenyl]benzonitrile.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)-5-hydroxy-2-phenylphenyl]benzonitrile |
|---|---|
| PubChem CID | 177464380 |
| Molecular Formula | C26H16N2OS |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)-5-hydroxy-2-phenylphenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(O)c(-c3nc4ccccc4s3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H16N2OS/c27-16-17-10-12-19(13-11-17)21-15-24(29)22(14-20(21)18-6-2-1-3-7-18)26-28-23-8-4-5-9-25(23)30-26/h1-15,29H |
| InChIKey | VCZIBGQVQJACKC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |