C18H16N2OS2 — CID 101031705
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-(2-sulfanylethyl)benzamide (PubChem CID 101031705) has the molecular formula C18H16N2OS2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-(2-sulfanylethyl)benzamide.
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 101031705 |
| Molecular Formula | C18H16N2OS2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-(2-sulfanylethyl)benzamide |
| SMILES | O=C(NCCS)c1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H16N2OS2/c21-18(19-11-12-22)14-8-5-13(6-9-14)7-10-17-20-15-3-1-2-4-16(15)23-17/h1-10,22H,11-12H2,(H,19,21)/b10-7+ |
| InChIKey | FFEQACMLZJWOTA-JXMROGBWSA-N |
| XLogP | 4.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|