C20H18N2O3S — CID 54330043
4-[[3-[2-(1,3-benzothiazol-2-yl)ethenyl]benzoyl]amino]butanoic acid (PubChem CID 54330043) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[[3-[2-(1,3-benzothiazol-2-yl)ethenyl]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[3-[2-(1,3-benzothiazol-2-yl)ethenyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 54330043 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[[3-[2-(1,3-benzothiazol-2-yl)ethenyl]benzoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1cccc(C=Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H18N2O3S/c23-19(24)9-4-12-21-20(25)15-6-3-5-14(13-15)10-11-18-22-16-7-1-2-8-17(16)26-18/h1-3,5-8,10-11,13H,4,9,12H2,(H,21,25)(H,23,24) |
| InChIKey | SXRPBJKTHSDSTC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|