C25H23N3O2S — CID 39777158
N-[4-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-4-oxobutyl]benzamide (PubChem CID 39777158) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[4-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39777158 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[4-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c29-23(11-6-16-26-25(30)19-7-2-1-3-8-19)27-20-14-12-18(13-15-20)17-24-28-21-9-4-5-10-22(21)31-24/h1-5,7-10,12-15H,6,11,16-17H2,(H,26,30)(H,27,29) |
| InChIKey | IDEWAFGTRAIHFX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|